C13H9BrF2O3S — CID 118022172
1-(2-bromo-4-methylsulfonylphenoxy)-2,4-difluorobenzene (PubChem CID 118022172) has the molecular formula C13H9BrF2O3S and a molecular weight of 363.18 g/mol. Its IUPAC name is 1-(2-bromo-4-methylsulfonylphenoxy)-2,4-difluorobenzene.
| Compound Name | 1-(2-bromo-4-methylsulfonylphenoxy)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 118022172 |
| Molecular Formula | C13H9BrF2O3S |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 1-(2-bromo-4-methylsulfonylphenoxy)-2,4-difluorobenzene |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(F)cc2F)c(Br)c1 |
| InChI | InChI=1S/C13H9BrF2O3S/c1-20(17,18)9-3-5-12(10(14)7-9)19-13-4-2-8(15)6-11(13)16/h2-7H,1H3 |
| InChIKey | AYENRQLLABGZNF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |