C13H6BrF2NO — CID 82798545
3-bromo-4-(2,4-difluorophenoxy)benzonitrile (PubChem CID 82798545) has the molecular formula C13H6BrF2NO and a molecular weight of 310.10 g/mol. Its IUPAC name is 3-bromo-4-(2,4-difluorophenoxy)benzonitrile.
| Compound Name | 3-bromo-4-(2,4-difluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 82798545 |
| Molecular Formula | C13H6BrF2NO |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 3-bromo-4-(2,4-difluorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(F)cc2F)c(Br)c1 |
| InChI | InChI=1S/C13H6BrF2NO/c14-10-5-8(7-17)1-3-12(10)18-13-4-2-9(15)6-11(13)16/h1-6H |
| InChIKey | WUNYTQKEVRBNEN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |