C13H5BrF3NO — CID 107098253
4-(5-bromo-2,3-difluorophenoxy)-3-fluorobenzonitrile (PubChem CID 107098253) has the molecular formula C13H5BrF3NO and a molecular weight of 328.09 g/mol. Its IUPAC name is 4-(5-bromo-2,3-difluorophenoxy)-3-fluorobenzonitrile.
| Compound Name | 4-(5-bromo-2,3-difluorophenoxy)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107098253 |
| Molecular Formula | C13H5BrF3NO |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 4-(5-bromo-2,3-difluorophenoxy)-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Br)cc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C13H5BrF3NO/c14-8-4-10(16)13(17)12(5-8)19-11-2-1-7(6-18)3-9(11)15/h1-5H |
| InChIKey | IGYMHGITUZHOFP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|