C15H10BrF2NO2 — CID 107098307
3-[(5-bromo-2,3-difluorophenoxy)methyl]-4-methoxybenzonitrile (PubChem CID 107098307) has the molecular formula C15H10BrF2NO2 and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-[(5-bromo-2,3-difluorophenoxy)methyl]-4-methoxybenzonitrile.
| Compound Name | 3-[(5-bromo-2,3-difluorophenoxy)methyl]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 107098307 |
| Molecular Formula | C15H10BrF2NO2 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 3-[(5-bromo-2,3-difluorophenoxy)methyl]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1COc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C15H10BrF2NO2/c1-20-13-3-2-9(7-19)4-10(13)8-21-14-6-11(16)5-12(17)15(14)18/h2-6H,8H2,1H3 |
| InChIKey | LLGXTYBBIJLTNF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|