C14H9BrF4O2 — CID 103289758
3-[(5-bromo-2-methoxyphenyl)methoxy]-1,2,4,5-tetrafluorobenzene (PubChem CID 103289758) has the molecular formula C14H9BrF4O2 and a molecular weight of 365.12 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)methoxy]-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)methoxy]-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 103289758 |
| Molecular Formula | C14H9BrF4O2 |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)methoxy]-1,2,4,5-tetrafluorobenzene |
| SMILES | COc1ccc(Br)cc1COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H9BrF4O2/c1-20-11-3-2-8(15)4-7(11)6-21-14-12(18)9(16)5-10(17)13(14)19/h2-5H,6H2,1H3 |
| InChIKey | SPVKXVUUMJAEJU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|