C15H10BrF2NO2 — CID 107100113
3-(5-bromo-2,3-difluorophenoxy)-4-[(1R)-1-hydroxyethyl]benzonitrile (PubChem CID 107100113) has the molecular formula C15H10BrF2NO2 and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-(5-bromo-2,3-difluorophenoxy)-4-[(1R)-1-hydroxyethyl]benzonitrile.
| Compound Name | 3-(5-bromo-2,3-difluorophenoxy)-4-[(1R)-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 107100113 |
| Molecular Formula | C15H10BrF2NO2 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 3-(5-bromo-2,3-difluorophenoxy)-4-[(1R)-1-hydroxyethyl]benzonitrile |
| SMILES | C[C@@H](O)c1ccc(C#N)cc1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C15H10BrF2NO2/c1-8(20)11-3-2-9(7-19)4-13(11)21-14-6-10(16)5-12(17)15(14)18/h2-6,8,20H,1H3/t8-/m1/s1 |
| InChIKey | NQOCGRYDPGYLDO-MRVPVSSYSA-N |
| XLogP | 4.44 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|