C14H10Br2F2O2 — CID 107100123
(1R)-1-[3-bromo-4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol (PubChem CID 107100123) has the molecular formula C14H10Br2F2O2 and a molecular weight of 408.04 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol.
| Compound Name | (1R)-1-[3-bromo-4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107100123 |
| Molecular Formula | C14H10Br2F2O2 |
| Molecular Weight | 408.04 g/mol |
| Exact Mass | 405.90 |
| IUPAC Name | (1R)-1-[3-bromo-4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(Oc2cc(Br)cc(F)c2F)c(Br)c1 |
| InChI | InChI=1S/C14H10Br2F2O2/c1-7(19)8-2-3-12(10(16)4-8)20-13-6-9(15)5-11(17)14(13)18/h2-7,19H,1H3/t7-/m1/s1 |
| InChIKey | NTCPICYOJMATHS-SSDOTTSWSA-N |
| XLogP | 5.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.04 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|