C14H11BrF2O2 — CID 107100098
1-[4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol (PubChem CID 107100098) has the molecular formula C14H11BrF2O2 and a molecular weight of 329.14 g/mol. Its IUPAC name is 1-[4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol.
| Compound Name | 1-[4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107100098 |
| Molecular Formula | C14H11BrF2O2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1-[4-(5-bromo-2,3-difluorophenoxy)phenyl]ethanol |
| SMILES | CC(O)c1ccc(Oc2cc(Br)cc(F)c2F)cc1 |
| InChI | InChI=1S/C14H11BrF2O2/c1-8(18)9-2-4-11(5-3-9)19-13-7-10(15)6-12(16)14(13)17/h2-8,18H,1H3 |
| InChIKey | DXJREQYZZWUGGQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|