C13H9ClF2O4S — CID 68843580
2-(2-chloro-4-methylsulfonylphenoxy)-4,5-difluorophenol (PubChem CID 68843580) has the molecular formula C13H9ClF2O4S and a molecular weight of 334.73 g/mol. Its IUPAC name is 2-(2-chloro-4-methylsulfonylphenoxy)-4,5-difluorophenol.
| Compound Name | 2-(2-chloro-4-methylsulfonylphenoxy)-4,5-difluorophenol |
|---|---|
| PubChem CID | 68843580 |
| Molecular Formula | C13H9ClF2O4S |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-(2-chloro-4-methylsulfonylphenoxy)-4,5-difluorophenol |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(F)c(F)cc2O)c(Cl)c1 |
| InChI | InChI=1S/C13H9ClF2O4S/c1-21(18,19)7-2-3-12(8(14)4-7)20-13-6-10(16)9(15)5-11(13)17/h2-6,17H,1H3 |
| InChIKey | KLQMBZVAEUQNLN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |