C11H13ClFNO3S — CID 42623112
(E)-4-(2-chloro-4-methylsulfonylphenoxy)-3-fluorobut-2-en-1-amine (PubChem CID 42623112) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is (E)-4-(2-chloro-4-methylsulfonylphenoxy)-3-fluorobut-2-en-1-amine.
| Compound Name | (E)-4-(2-chloro-4-methylsulfonylphenoxy)-3-fluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 42623112 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (E)-4-(2-chloro-4-methylsulfonylphenoxy)-3-fluorobut-2-en-1-amine |
| SMILES | CS(=O)(=O)c1ccc(OC/C(F)=C\CN)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClFNO3S/c1-18(15,16)9-2-3-11(10(12)6-9)17-7-8(13)4-5-14/h2-4,6H,5,7,14H2,1H3/b8-4+ |
| InChIKey | ITCFVEUDZNZXGP-XBXARRHUSA-N |
| XLogP | 1.93 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |