C16H14ClFO5S — CID 143006225
3-[2-(2-chloro-4-methylsulfonylphenoxy)-4-fluorophenoxy]prop-1-en-2-ol (PubChem CID 143006225) has the molecular formula C16H14ClFO5S and a molecular weight of 372.80 g/mol. Its IUPAC name is 3-[2-(2-chloro-4-methylsulfonylphenoxy)-4-fluorophenoxy]prop-1-en-2-ol.
| Compound Name | 3-[2-(2-chloro-4-methylsulfonylphenoxy)-4-fluorophenoxy]prop-1-en-2-ol |
|---|---|
| PubChem CID | 143006225 |
| Molecular Formula | C16H14ClFO5S |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 3-[2-(2-chloro-4-methylsulfonylphenoxy)-4-fluorophenoxy]prop-1-en-2-ol |
| SMILES | C=C(O)COc1ccc(F)cc1Oc1ccc(S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C16H14ClFO5S/c1-10(19)9-22-15-5-3-11(18)7-16(15)23-14-6-4-12(8-13(14)17)24(2,20)21/h3-8,19H,1,9H2,2H3 |
| InChIKey | RUQKXJZNSPAAKT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|