C16H14Cl2O6S — CID 11338670
2-[4-chloro-2-(2-chloro-4-ethylsulfonylphenoxy)phenoxy]acetic acid (PubChem CID 11338670) has the molecular formula C16H14Cl2O6S and a molecular weight of 405.26 g/mol. Its IUPAC name is 2-[4-chloro-2-(2-chloro-4-ethylsulfonylphenoxy)phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-(2-chloro-4-ethylsulfonylphenoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 11338670 |
| Molecular Formula | C16H14Cl2O6S |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 2-[4-chloro-2-(2-chloro-4-ethylsulfonylphenoxy)phenoxy]acetic acid |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc(Cl)ccc2OCC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O6S/c1-2-25(21,22)11-4-6-13(12(18)8-11)24-15-7-10(17)3-5-14(15)23-9-16(19)20/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | UBLYUSFUHDOYHN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |