C12H8ClF2NO3S — CID 63268736
3-chloro-4-(2,5-difluorophenoxy)benzenesulfonamide (PubChem CID 63268736) has the molecular formula C12H8ClF2NO3S and a molecular weight of 319.72 g/mol. Its IUPAC name is 3-chloro-4-(2,5-difluorophenoxy)benzenesulfonamide.
| Compound Name | 3-chloro-4-(2,5-difluorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63268736 |
| Molecular Formula | C12H8ClF2NO3S |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-chloro-4-(2,5-difluorophenoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2cc(F)ccc2F)c(Cl)c1 |
| InChI | InChI=1S/C12H8ClF2NO3S/c13-9-6-8(20(16,17)18)2-4-11(9)19-12-5-7(14)1-3-10(12)15/h1-6H,(H2,16,17,18) |
| InChIKey | ZSJFIDUCAMMPOQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |