C12H9Cl2NO3S — CID 2805105
2-(2,4-dichlorophenoxy)benzenesulfonamide (PubChem CID 2805105) has the molecular formula C12H9Cl2NO3S and a molecular weight of 318.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)benzenesulfonamide.
| Compound Name | 2-(2,4-dichlorophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 2805105 |
| Molecular Formula | C12H9Cl2NO3S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2NO3S/c13-8-5-6-10(9(14)7-8)18-11-3-1-2-4-12(11)19(15,16)17/h1-7H,(H2,15,16,17) |
| InChIKey | PUNZKJOQZFWYSS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |