C12H13Cl3O10P2 — CID 87201530
5-chloro-2-(2,4-dichlorophenoxy)phenol;phosphoric acid (PubChem CID 87201530) has the molecular formula C12H13Cl3O10P2 and a molecular weight of 485.53 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenoxy)phenol;phosphoric acid.
| Compound Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;phosphoric acid |
|---|---|
| PubChem CID | 87201530 |
| Molecular Formula | C12H13Cl3O10P2 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 483.90 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;phosphoric acid |
| SMILES | O=P(O)(O)O.O=P(O)(O)O.Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2.2H3O4P/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16;2*1-5(2,3)4/h1-6,16H;2*(H3,1,2,3,4) |
| InChIKey | LUXHFCYVDASIQR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|