C13H9Cl3O2 — CID 23656591
5-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol (PubChem CID 23656591) has the molecular formula C13H9Cl3O2 and a molecular weight of 303.57 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol.
| Compound Name | 5-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol |
|---|---|
| PubChem CID | 23656591 |
| Molecular Formula | C13H9Cl3O2 |
| Molecular Weight | 303.57 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 5-(chloromethyl)-2-(2,4-dichlorophenoxy)phenol |
| SMILES | Oc1cc(CCl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl3O2/c14-7-8-1-3-13(11(17)5-8)18-12-4-2-9(15)6-10(12)16/h1-6,17H,7H2 |
| InChIKey | XVCALTYAVXDHNO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|