C19H21Cl2NO2 — CID 71733465
5-[(cyclohexylamino)methyl]-2-(2,4-dichlorophenoxy)phenol (PubChem CID 71733465) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 5-[(cyclohexylamino)methyl]-2-(2,4-dichlorophenoxy)phenol.
| Compound Name | 5-[(cyclohexylamino)methyl]-2-(2,4-dichlorophenoxy)phenol |
|---|---|
| PubChem CID | 71733465 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-[(cyclohexylamino)methyl]-2-(2,4-dichlorophenoxy)phenol |
| SMILES | Oc1cc(CNC2CCCCC2)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl2NO2/c20-14-7-9-18(16(21)11-14)24-19-8-6-13(10-17(19)23)12-22-15-4-2-1-3-5-15/h6-11,15,22-23H,1-5,12H2 |
| InChIKey | HKVCRMWOJBUMKF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |