C21H26BrCl2NO — CID 17057052
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cycloheptanamine;hydrochloride (PubChem CID 17057052) has the molecular formula C21H26BrCl2NO and a molecular weight of 459.26 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cycloheptanamine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cycloheptanamine;hydrochloride |
|---|---|
| PubChem CID | 17057052 |
| Molecular Formula | C21H26BrCl2NO |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cycloheptanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(COc2ccc(CNC3CCCCCC3)cc2Br)cc1 |
| InChI | InChI=1S/C21H25BrClNO.ClH/c22-20-13-17(14-24-19-5-3-1-2-4-6-19)9-12-21(20)25-15-16-7-10-18(23)11-8-16;/h7-13,19,24H,1-6,14-15H2;1H |
| InChIKey | SVLJEUGFJNWCSG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |