C17H18BrCl2NO — CID 17057050
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine;hydrochloride (PubChem CID 17057050) has the molecular formula C17H18BrCl2NO and a molecular weight of 403.15 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine;hydrochloride |
|---|---|
| PubChem CID | 17057050 |
| Molecular Formula | C17H18BrCl2NO |
| Molecular Weight | 403.15 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(COc2ccc(CNC3CC3)cc2Br)cc1 |
| InChI | InChI=1S/C17H17BrClNO.ClH/c18-16-9-13(10-20-15-6-7-15)3-8-17(16)21-11-12-1-4-14(19)5-2-12;/h1-5,8-9,15,20H,6-7,10-11H2;1H |
| InChIKey | YSGSQNJESSGYDD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.15 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |