C16H25Cl2NO — CID 17158351
N-[(3-chloro-4-ethoxyphenyl)methyl]cycloheptanamine;hydrochloride (PubChem CID 17158351) has the molecular formula C16H25Cl2NO and a molecular weight of 318.29 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxyphenyl)methyl]cycloheptanamine;hydrochloride.
| Compound Name | N-[(3-chloro-4-ethoxyphenyl)methyl]cycloheptanamine;hydrochloride |
|---|---|
| PubChem CID | 17158351 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[(3-chloro-4-ethoxyphenyl)methyl]cycloheptanamine;hydrochloride |
| SMILES | CCOc1ccc(CNC2CCCCCC2)cc1Cl.Cl |
| InChI | InChI=1S/C16H24ClNO.ClH/c1-2-19-16-10-9-13(11-15(16)17)12-18-14-7-5-3-4-6-8-14;/h9-11,14,18H,2-8,12H2,1H3;1H |
| InChIKey | UBPSHWSYGIKHHE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |