C19H30ClNO2 — CID 66532386
N-[(2-chloro-4,5-diethoxyphenyl)methyl]cyclooctanamine (PubChem CID 66532386) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is N-[(2-chloro-4,5-diethoxyphenyl)methyl]cyclooctanamine.
| Compound Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]cyclooctanamine |
|---|---|
| PubChem CID | 66532386 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-[(2-chloro-4,5-diethoxyphenyl)methyl]cyclooctanamine |
| SMILES | CCOc1cc(Cl)c(CNC2CCCCCCC2)cc1OCC |
| InChI | InChI=1S/C19H30ClNO2/c1-3-22-18-12-15(17(20)13-19(18)23-4-2)14-21-16-10-8-6-5-7-9-11-16/h12-13,16,21H,3-11,14H2,1-2H3 |
| InChIKey | BGPHBEIPPVOCOR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |