C16H13Cl3O4 — CID 67533473
5-chloro-2-(2,4-dichlorophenoxy)phenol;2-methylprop-2-enoic acid (PubChem CID 67533473) has the molecular formula C16H13Cl3O4 and a molecular weight of 375.64 g/mol. Its IUPAC name is 5-chloro-2-(2,4-dichlorophenoxy)phenol;2-methylprop-2-enoic acid.
| Compound Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67533473 |
| Molecular Formula | C16H13Cl3O4 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2.C4H6O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16;1-3(2)4(5)6/h1-6,16H;1H2,2H3,(H,5,6) |
| InChIKey | SQJPLBVMVJCFLD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|