C13H8Cl2N2O2S — CID 58710218
5-chloro-6-(4-chloro-2-hydroxyphenoxy)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 58710218) has the molecular formula C13H8Cl2N2O2S and a molecular weight of 327.19 g/mol. Its IUPAC name is 5-chloro-6-(4-chloro-2-hydroxyphenoxy)-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-chloro-6-(4-chloro-2-hydroxyphenoxy)-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 58710218 |
| Molecular Formula | C13H8Cl2N2O2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 5-chloro-6-(4-chloro-2-hydroxyphenoxy)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | Oc1cc(Cl)ccc1Oc1cc2[nH]c(=S)[nH]c2cc1Cl |
| InChI | InChI=1S/C13H8Cl2N2O2S/c14-6-1-2-11(10(18)3-6)19-12-5-9-8(4-7(12)15)16-13(20)17-9/h1-5,18H,(H2,16,17,20) |
| InChIKey | UWCXUOSMSGHKJB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|