C12H6Cl4O3 — CID 100954533
4,5-dichloro-2-(4,5-dichloro-2-hydroxyphenoxy)phenol (PubChem CID 100954533) has the molecular formula C12H6Cl4O3 and a molecular weight of 339.99 g/mol. Its IUPAC name is 4,5-dichloro-2-(4,5-dichloro-2-hydroxyphenoxy)phenol.
| Compound Name | 4,5-dichloro-2-(4,5-dichloro-2-hydroxyphenoxy)phenol |
|---|---|
| PubChem CID | 100954533 |
| Molecular Formula | C12H6Cl4O3 |
| Molecular Weight | 339.99 g/mol |
| Exact Mass | 337.91 |
| IUPAC Name | 4,5-dichloro-2-(4,5-dichloro-2-hydroxyphenoxy)phenol |
| SMILES | Oc1cc(Cl)c(Cl)cc1Oc1cc(Cl)c(Cl)cc1O |
| InChI | InChI=1S/C12H6Cl4O3/c13-5-1-9(17)11(3-7(5)15)19-12-4-8(16)6(14)2-10(12)18/h1-4,17-18H |
| InChIKey | PAICNNYXQXWSGQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.99 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |