C12H8Cl2O3 — CID 14591774
2,5-dichloro-4-(4-hydroxyphenoxy)phenol (PubChem CID 14591774) has the molecular formula C12H8Cl2O3 and a molecular weight of 271.10 g/mol. Its IUPAC name is 2,5-dichloro-4-(4-hydroxyphenoxy)phenol.
| Compound Name | 2,5-dichloro-4-(4-hydroxyphenoxy)phenol |
|---|---|
| PubChem CID | 14591774 |
| Molecular Formula | C12H8Cl2O3 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 2,5-dichloro-4-(4-hydroxyphenoxy)phenol |
| SMILES | Oc1ccc(Oc2cc(Cl)c(O)cc2Cl)cc1 |
| InChI | InChI=1S/C12H8Cl2O3/c13-9-6-12(10(14)5-11(9)16)17-8-3-1-7(15)2-4-8/h1-6,15-16H |
| InChIKey | WXQMCPZQAQFLIY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |