About 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol
3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol (PubChem CID 164986492) has the molecular formula C26H17Cl4FO4
and a molecular weight of 554.23 g/mol. Its IUPAC name is 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol.
Molecular Properties
| Compound Name | 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol |
| PubChem CID | 164986492 |
| Molecular Formula | C26H17Cl4FO4 |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 551.99 |
| IUPAC Name | 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol |
| SMILES | O=Cc1ccc(F)c(Cl)c1.O=Cc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H8Cl2O2.C7H4ClFO.C6H5ClO/c14-10-2-4-11(5-3-10)17-13-6-1-9(8-16)7-12(13)15;8-6-3-5(4-10)1-2-7(6)9;7-5-1-3-6(8)4-2-5/h1-8H;1-4H;1-4,8H |
| InChIKey | GFVCJMBLIYHJNM-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol?
The IUPAC name of 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol (CID 164986492) is 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol.
What is the SMILES notation for 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol?
The canonical SMILES for 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol is O=Cc1ccc(F)c(Cl)c1.O=Cc1ccc(Oc2ccc(Cl)cc2)c(Cl)c1.Oc1ccc(Cl)cc1.
What is the InChIKey of 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol?
The InChIKey is GFVCJMBLIYHJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2O2.C7H4ClFO.C6H5ClO/c14-10-2-4-11(5-3-10)17-13-6-1-9(8-16)7-12(13)15;8-6-3-5(4-10)1-2-7(6)9;7-5-1-3-6(8)4-2-5/h1-8H;1-4H;1-4,8H.
What are the key properties of 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol?
3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol has a molecular weight of 554.23 g/mol, XLogP of 8.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(4-chlorophenoxy)benzaldehyde;3-chloro-4-fluorobenzaldehyde;4-chlorophenol is sourced from PubChem (CID 164986492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).