C15H9ClF2O3 — CID 81150944
(E)-3-[3-chloro-4-(3,4-difluorophenoxy)phenyl]prop-2-enoic acid (PubChem CID 81150944) has the molecular formula C15H9ClF2O3 and a molecular weight of 310.68 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(3,4-difluorophenoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-4-(3,4-difluorophenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81150944 |
| Molecular Formula | C15H9ClF2O3 |
| Molecular Weight | 310.68 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (E)-3-[3-chloro-4-(3,4-difluorophenoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Oc2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H9ClF2O3/c16-11-7-9(2-6-15(19)20)1-5-14(11)21-10-3-4-12(17)13(18)8-10/h1-8H,(H,19,20)/b6-2+ |
| InChIKey | YWBIRTFUOUZPBB-QHHAFSJGSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|