C12H10O5 — CID 14020522
2-(4-hydroxyphenoxy)benzene-1,3,5-triol (PubChem CID 14020522) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 2-(4-hydroxyphenoxy)benzene-1,3,5-triol.
| Compound Name | 2-(4-hydroxyphenoxy)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 14020522 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(4-hydroxyphenoxy)benzene-1,3,5-triol |
| SMILES | Oc1ccc(Oc2c(O)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C12H10O5/c13-7-1-3-9(4-2-7)17-12-10(15)5-8(14)6-11(12)16/h1-6,13-16H |
| InChIKey | SGBNKUZUONLIQG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |