C14H16O5 — CID 68628937
ethane-1,2-diol;4-(4-hydroxyphenoxy)phenol (PubChem CID 68628937) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethane-1,2-diol;4-(4-hydroxyphenoxy)phenol.
| Compound Name | ethane-1,2-diol;4-(4-hydroxyphenoxy)phenol |
|---|---|
| PubChem CID | 68628937 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | ethane-1,2-diol;4-(4-hydroxyphenoxy)phenol |
| SMILES | OCCO.Oc1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O3.C2H6O2/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;3-1-2-4/h1-8,13-14H;3-4H,1-2H2 |
| InChIKey | QLNXSPXRQQQBPJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |