About 4-phenoxyphenol;propanoic acid
4-phenoxyphenol;propanoic acid (PubChem CID 67658817) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-phenoxyphenol;propanoic acid.
Molecular Properties
| Compound Name | 4-phenoxyphenol;propanoic acid |
| PubChem CID | 67658817 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-phenoxyphenol;propanoic acid |
| SMILES | CCC(=O)O.Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O2.C3H6O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-2-3(4)5/h1-9,13H;2H2,1H3,(H,4,5) |
| InChIKey | QFJWCLUJDCZORQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenoxyphenol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxyphenol;propanoic acid?
The IUPAC name of 4-phenoxyphenol;propanoic acid (CID 67658817) is 4-phenoxyphenol;propanoic acid.
What is the SMILES notation for 4-phenoxyphenol;propanoic acid?
The canonical SMILES for 4-phenoxyphenol;propanoic acid is CCC(=O)O.Oc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxyphenol;propanoic acid?
The InChIKey is QFJWCLUJDCZORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C3H6O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-2-3(4)5/h1-9,13H;2H2,1H3,(H,4,5).
What are the key properties of 4-phenoxyphenol;propanoic acid?
4-phenoxyphenol;propanoic acid has a molecular weight of 260.29 g/mol, XLogP of 3.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxyphenol;propanoic acid is sourced from PubChem (CID 67658817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).