4-phenoxyphenol;propanoic acid

C15H16O4 — CID 67658817

IUPAC4-phenoxyphenol;propanoic acid
SMILESCCC(=O)O.Oc1ccc(Oc2ccccc2)cc1
InChIInChI=1S/C12H10O2.C3H6O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-2-3(4)5/h1-9,13H;2H2,1H3,(H,4,5)
InChIKeyQFJWCLUJDCZORQ-UHFFFAOYSA-N
MW260.29 g/mol
LogP3.67
Rot. Bonds3

About 4-phenoxyphenol;propanoic acid

4-phenoxyphenol;propanoic acid (PubChem CID 67658817) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-phenoxyphenol;propanoic acid.

Molecular Properties

Compound Name4-phenoxyphenol;propanoic acid
PubChem CID67658817
Molecular FormulaC15H16O4
Molecular Weight260.29 g/mol
Exact Mass260.10
IUPAC Name4-phenoxyphenol;propanoic acid
SMILESCCC(=O)O.Oc1ccc(Oc2ccccc2)cc1
InChIInChI=1S/C12H10O2.C3H6O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-2-3(4)5/h1-9,13H;2H2,1H3,(H,4,5)
InChIKeyQFJWCLUJDCZORQ-UHFFFAOYSA-N
XLogP3.67
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 53.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-phenoxyphenol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-phenoxyphenol;propanoic acid?
The IUPAC name of 4-phenoxyphenol;propanoic acid (CID 67658817) is 4-phenoxyphenol;propanoic acid.
What is the SMILES notation for 4-phenoxyphenol;propanoic acid?
The canonical SMILES for 4-phenoxyphenol;propanoic acid is CCC(=O)O.Oc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 4-phenoxyphenol;propanoic acid?
The InChIKey is QFJWCLUJDCZORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C3H6O2/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-2-3(4)5/h1-9,13H;2H2,1H3,(H,4,5).
What are the key properties of 4-phenoxyphenol;propanoic acid?
4-phenoxyphenol;propanoic acid has a molecular weight of 260.29 g/mol, XLogP of 3.67, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxyphenol;propanoic acid is sourced from PubChem (CID 67658817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).