C39H33N3O6 — CID 140912996
4-[4-[3,5-bis[4-(4-hydroxyphenoxy)phenyl]-1,3,5-triazinan-1-yl]phenoxy]phenol (PubChem CID 140912996) has the molecular formula C39H33N3O6 and a molecular weight of 639.71 g/mol. Its IUPAC name is 4-[4-[3,5-bis[4-(4-hydroxyphenoxy)phenyl]-1,3,5-triazinan-1-yl]phenoxy]phenol.
| Compound Name | 4-[4-[3,5-bis[4-(4-hydroxyphenoxy)phenyl]-1,3,5-triazinan-1-yl]phenoxy]phenol |
|---|---|
| PubChem CID | 140912996 |
| Molecular Formula | C39H33N3O6 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 4-[4-[3,5-bis[4-(4-hydroxyphenoxy)phenyl]-1,3,5-triazinan-1-yl]phenoxy]phenol |
| SMILES | Oc1ccc(Oc2ccc(N3CN(c4ccc(Oc5ccc(O)cc5)cc4)CN(c4ccc(Oc5ccc(O)cc5)cc4)C3)cc2)cc1 |
| InChI | InChI=1S/C39H33N3O6/c43-31-7-19-37(20-8-31)46-34-13-1-28(2-14-34)40-25-41(29-3-15-35(16-4-29)47-38-21-9-32(44)10-22-38)27-42(26-40)30-5-17-36(18-6-30)48-39-23-11-33(45)12-24-39/h1-24,43-45H,25-27H2 |
| InChIKey | KRDRXHBVFNTFLX-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |