C35H30N2O8 — CID 158451070
bis(1-[4-(4-hydroxyphenoxy)phenyl]pyrrole-2,5-dione);propane (PubChem CID 158451070) has the molecular formula C35H30N2O8 and a molecular weight of 606.63 g/mol. Its IUPAC name is bis(1-[4-(4-hydroxyphenoxy)phenyl]pyrrole-2,5-dione);propane.
| Compound Name | bis(1-[4-(4-hydroxyphenoxy)phenyl]pyrrole-2,5-dione);propane |
|---|---|
| PubChem CID | 158451070 |
| Molecular Formula | C35H30N2O8 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | bis(1-[4-(4-hydroxyphenoxy)phenyl]pyrrole-2,5-dione);propane |
| SMILES | CCC.O=C1C=CC(=O)N1c1ccc(Oc2ccc(O)cc2)cc1.O=C1C=CC(=O)N1c1ccc(Oc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/2C16H11NO4.C3H8/c2*18-12-3-7-14(8-4-12)21-13-5-1-11(2-6-13)17-15(19)9-10-16(17)20;1-3-2/h2*1-10,18H;3H2,1-2H3 |
| InChIKey | HDZJTLJDCRDBBF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|