C36H28N2O5 — CID 163499593
1-[4-[[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione (PubChem CID 163499593) has the molecular formula C36H28N2O5 and a molecular weight of 568.63 g/mol. Its IUPAC name is 1-[4-[[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163499593 |
| Molecular Formula | C36H28N2O5 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 1-[4-[[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)(c1ccc(Cc2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C36H28N2O5/c1-36(2,26-7-3-24(4-8-26)23-25-5-11-28(12-6-25)37-32(39)19-20-33(37)40)27-9-15-30(16-10-27)43-31-17-13-29(14-18-31)38-34(41)21-22-35(38)42/h3-22H,23H2,1-2H3 |
| InChIKey | CTOUHXOSMFXIIN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|