C36H27NO6 — CID 177130091
1-[4-[4-[2-[4-[4-(2,5-dioxocyclopent-3-en-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 177130091) has the molecular formula C36H27NO6 and a molecular weight of 569.61 g/mol. Its IUPAC name is 1-[4-[4-[2-[4-[4-(2,5-dioxocyclopent-3-en-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-[2-[4-[4-(2,5-dioxocyclopent-3-en-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 177130091 |
| Molecular Formula | C36H27NO6 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1-[4-[4-[2-[4-[4-(2,5-dioxocyclopent-3-en-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)(c1ccc(Oc2ccc(C3C(=O)C=CC3=O)cc2)cc1)c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C36H27NO6/c1-36(2,24-5-13-28(14-6-24)42-27-11-3-23(4-12-27)35-31(38)19-20-32(35)39)25-7-15-29(16-8-25)43-30-17-9-26(10-18-30)37-33(40)21-22-34(37)41/h3-22,35H,1-2H3 |
| InChIKey | KTFNBDPUKFRLCU-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|