C19H11F6NO3 — CID 22079278
1-[4-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 22079278) has the molecular formula C19H11F6NO3 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-[4-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22079278 |
| Molecular Formula | C19H11F6NO3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 1-[4-[4-(1,1,1,2,3,3-hexafluoropropan-2-yl)phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(Oc2ccc(C(F)(C(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H11F6NO3/c20-17(21)18(22,19(23,24)25)11-1-5-13(6-2-11)29-14-7-3-12(4-8-14)26-15(27)9-10-16(26)28/h1-10,17H |
| InChIKey | NCKXJWZEQFIANH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|