C42H22N4O10 — CID 15248747
2,6-bis[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 15248747) has the molecular formula C42H22N4O10 and a molecular weight of 742.66 g/mol. Its IUPAC name is 2,6-bis[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 15248747 |
| Molecular Formula | C42H22N4O10 |
| Molecular Weight | 742.66 g/mol |
| Exact Mass | 742.13 |
| IUPAC Name | 2,6-bis[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=C1C=CC(=O)N1c1ccc(Oc2ccc(-n3c(=O)c4cc5c(=O)n(-c6ccc(Oc7ccc(N8C(=O)C=CC8=O)cc7)cc6)c(=O)c5cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C42H22N4O10/c47-35-17-18-36(48)43(35)23-1-9-27(10-2-23)55-29-13-5-25(6-14-29)45-39(51)31-21-33-34(22-32(31)40(45)52)42(54)46(41(33)53)26-7-15-30(16-8-26)56-28-11-3-24(4-12-28)44-37(49)19-20-38(44)50/h1-22H |
| InChIKey | WFUHNWCOJXAPEO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 171.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|