C21H21N3O3 — CID 130393627
4-[3,5-bis(4-hydroxyphenyl)-1,3,5-triazinan-1-yl]phenol (PubChem CID 130393627) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-[3,5-bis(4-hydroxyphenyl)-1,3,5-triazinan-1-yl]phenol.
| Compound Name | 4-[3,5-bis(4-hydroxyphenyl)-1,3,5-triazinan-1-yl]phenol |
|---|---|
| PubChem CID | 130393627 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[3,5-bis(4-hydroxyphenyl)-1,3,5-triazinan-1-yl]phenol |
| SMILES | Oc1ccc(N2CN(c3ccc(O)cc3)CN(c3ccc(O)cc3)C2)cc1 |
| InChI | InChI=1S/C21H21N3O3/c25-19-7-1-16(2-8-19)22-13-23(17-3-9-20(26)10-4-17)15-24(14-22)18-5-11-21(27)12-6-18/h1-12,25-27H,13-15H2 |
| InChIKey | PFYSEMNZYHCWQQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |