C11H15NO2 — CID 175084145
4-(1,3-oxazepan-3-yl)phenol (PubChem CID 175084145) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(1,3-oxazepan-3-yl)phenol.
| Compound Name | 4-(1,3-oxazepan-3-yl)phenol |
|---|---|
| PubChem CID | 175084145 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(1,3-oxazepan-3-yl)phenol |
| SMILES | Oc1ccc(N2CCCCOC2)cc1 |
| InChI | InChI=1S/C11H15NO2/c13-11-5-3-10(4-6-11)12-7-1-2-8-14-9-12/h3-6,13H,1-2,7-9H2 |
| InChIKey | MABBWQXFIPOOQN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |