C11H14INO — CID 121246914
4-(4-iodophenyl)-1,4-oxazepane (PubChem CID 121246914) has the molecular formula C11H14INO and a molecular weight of 303.14 g/mol. Its IUPAC name is 4-(4-iodophenyl)-1,4-oxazepane.
| Compound Name | 4-(4-iodophenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 121246914 |
| Molecular Formula | C11H14INO |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-(4-iodophenyl)-1,4-oxazepane |
| SMILES | Ic1ccc(N2CCCOCC2)cc1 |
| InChI | InChI=1S/C11H14INO/c12-10-2-4-11(5-3-10)13-6-1-8-14-9-7-13/h2-5H,1,6-9H2 |
| InChIKey | WBWMUKRAFBISMB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|