C12H17FN2O — CID 115366849
[2-fluoro-4-(1,4-oxazepan-4-yl)phenyl]methanamine (PubChem CID 115366849) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is [2-fluoro-4-(1,4-oxazepan-4-yl)phenyl]methanamine.
| Compound Name | [2-fluoro-4-(1,4-oxazepan-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 115366849 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | [2-fluoro-4-(1,4-oxazepan-4-yl)phenyl]methanamine |
| SMILES | NCc1ccc(N2CCCOCC2)cc1F |
| InChI | InChI=1S/C12H17FN2O/c13-12-8-11(3-2-10(12)9-14)15-4-1-6-16-7-5-15/h2-3,8H,1,4-7,9,14H2 |
| InChIKey | JFZXPAYUXYVQMU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |