C15H21FN2O3 — CID 170885664
ethyl 2-amino-3-(2-fluoro-4-morpholin-4-ylphenyl)propanoate (PubChem CID 170885664) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-fluoro-4-morpholin-4-ylphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(2-fluoro-4-morpholin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 170885664 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | ethyl 2-amino-3-(2-fluoro-4-morpholin-4-ylphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(N2CCOCC2)cc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-2-21-15(19)14(17)9-11-3-4-12(10-13(11)16)18-5-7-20-8-6-18/h3-4,10,14H,2,5-9,17H2,1H3 |
| InChIKey | QFVKVIWHNGTSEJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |