C17H26N2O5 — CID 170885779
ethyl 2-amino-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)propanoate (PubChem CID 170885779) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is ethyl 2-amino-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 170885779 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | ethyl 2-amino-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(OC)c(N2CCOCC2)cc1OC |
| InChI | InChI=1S/C17H26N2O5/c1-4-24-17(20)13(18)9-12-10-16(22-3)14(11-15(12)21-2)19-5-7-23-8-6-19/h10-11,13H,4-9,18H2,1-3H3 |
| InChIKey | CJJDQSODDYCCHT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |