About methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate
methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate (PubChem CID 170884270) has the molecular formula C14H18Cl2N2O3
and a molecular weight of 333.21 g/mol. Its IUPAC name is methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate.
Molecular Properties
| Compound Name | methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate |
| PubChem CID | 170884270 |
| Molecular Formula | C14H18Cl2N2O3 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(Cl)c(N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O3/c1-20-14(19)12(17)7-9-6-11(16)13(8-10(9)15)18-2-4-21-5-3-18/h6,8,12H,2-5,7,17H2,1H3 |
| InChIKey | JOYGTHPXPAIFOG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate?
The IUPAC name of methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate (CID 170884270) is methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate?
The canonical SMILES for methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate is COC(=O)C(N)Cc1cc(Cl)c(N2CCOCC2)cc1Cl.
What is the InChIKey of methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate?
The InChIKey is JOYGTHPXPAIFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Cl2N2O3/c1-20-14(19)12(17)7-9-6-11(16)13(8-10(9)15)18-2-4-21-5-3-18/h6,8,12H,2-5,7,17H2,1H3.
What are the key properties of methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate?
methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate has a molecular weight of 333.21 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(2,5-dichloro-4-morpholin-4-ylphenyl)propanoate is sourced from PubChem (CID 170884270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).