C16H24N2O3 — CID 170884277
methyl 2-amino-3-(2,6-dimethyl-4-morpholin-4-ylphenyl)propanoate (PubChem CID 170884277) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 2-amino-3-(2,6-dimethyl-4-morpholin-4-ylphenyl)propanoate.
| Compound Name | methyl 2-amino-3-(2,6-dimethyl-4-morpholin-4-ylphenyl)propanoate |
|---|---|
| PubChem CID | 170884277 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 2-amino-3-(2,6-dimethyl-4-morpholin-4-ylphenyl)propanoate |
| SMILES | COC(=O)C(N)Cc1c(C)cc(N2CCOCC2)cc1C |
| InChI | InChI=1S/C16H24N2O3/c1-11-8-13(18-4-6-21-7-5-18)9-12(2)14(11)10-15(17)16(19)20-3/h8-9,15H,4-7,10,17H2,1-3H3 |
| InChIKey | DBDHGKZUJCVJKQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |