methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate

C12H17NO3 — CID 155822076

IUPACmethyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate
SMILESCOC(=O)C(N)Cc1c(C)cc(C)cc1O
InChIInChI=1S/C12H17NO3/c1-7-4-8(2)9(11(14)5-7)6-10(13)12(15)16-3/h4-5,10,14H,6,13H2,1-3H3
InChIKeyCLRSZVWSTFJKSE-UHFFFAOYSA-N
MW223.27 g/mol
LogP1.05
Rot. Bonds3

About methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate

methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate (PubChem CID 155822076) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate
PubChem CID155822076
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Namemethyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate
SMILESCOC(=O)C(N)Cc1c(C)cc(C)cc1O
InChIInChI=1S/C12H17NO3/c1-7-4-8(2)9(11(14)5-7)6-10(13)12(15)16-3/h4-5,10,14H,6,13H2,1-3H3
InChIKeyCLRSZVWSTFJKSE-UHFFFAOYSA-N
XLogP1.05
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate?
The IUPAC name of methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate (CID 155822076) is methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate?
The canonical SMILES for methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate is COC(=O)C(N)Cc1c(C)cc(C)cc1O.
What is the InChIKey of methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate?
The InChIKey is CLRSZVWSTFJKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-7-4-8(2)9(11(14)5-7)6-10(13)12(15)16-3/h4-5,10,14H,6,13H2,1-3H3.
What are the key properties of methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate?
methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate has a molecular weight of 223.27 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(2-hydroxy-4,6-dimethylphenyl)propanoate is sourced from PubChem (CID 155822076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).