About ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate
ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate (PubChem CID 170885118) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate |
| PubChem CID | 170885118 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1c(C)cc(O)cc1O |
| InChI | InChI=1S/C12H17NO4/c1-3-17-12(16)10(13)6-9-7(2)4-8(14)5-11(9)15/h4-5,10,14-15H,3,6,13H2,1-2H3 |
| InChIKey | OPEBLNJVGFTSSX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate?
The IUPAC name of ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate (CID 170885118) is ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate.
What is the SMILES notation for ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate?
The canonical SMILES for ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate is CCOC(=O)C(N)Cc1c(C)cc(O)cc1O.
What is the InChIKey of ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate?
The InChIKey is OPEBLNJVGFTSSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-3-17-12(16)10(13)6-9-7(2)4-8(14)5-11(9)15/h4-5,10,14-15H,3,6,13H2,1-2H3.
What are the key properties of ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate?
ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate has a molecular weight of 239.27 g/mol, XLogP of 0.84, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-3-(2,4-dihydroxy-6-methylphenyl)propanoate is sourced from PubChem (CID 170885118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).