C13H20N2O2 — CID 75009597
2-amino-N-ethyl-3-(4-hydroxy-2,6-dimethylphenyl)propanamide (PubChem CID 75009597) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-amino-N-ethyl-3-(4-hydroxy-2,6-dimethylphenyl)propanamide.
| Compound Name | 2-amino-N-ethyl-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 75009597 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-amino-N-ethyl-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
| SMILES | CCNC(=O)C(N)Cc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C13H20N2O2/c1-4-15-13(17)12(14)7-11-8(2)5-10(16)6-9(11)3/h5-6,12,16H,4,7,14H2,1-3H3,(H,15,17) |
| InChIKey | IPSZXPJFPXMRRM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |