C24H34N4O3 — CID 10960900
(2S)-2-amino-N-[4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]butyl]-3-phenylpropanamide (PubChem CID 10960900) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]butyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]butyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 10960900 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (2S)-2-amino-N-[4-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]butyl]-3-phenylpropanamide |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](N)C(=O)NCCCCNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N4O3/c1-16-12-19(29)13-17(2)20(16)15-22(26)24(31)28-11-7-6-10-27-23(30)21(25)14-18-8-4-3-5-9-18/h3-5,8-9,12-13,21-22,29H,6-7,10-11,14-15,25-26H2,1-2H3,(H,27,30)(H,28,31)/t21-,22-/m0/s1 |
| InChIKey | HMTQHYZKAYZSKP-VXKWHMMOSA-N |
| XLogP | 1.46 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|