C22H30N2O2S — CID 14852306
2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-(3-phenylpropylsulfanyl)ethyl]propanamide (PubChem CID 14852306) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-(3-phenylpropylsulfanyl)ethyl]propanamide.
| Compound Name | 2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-(3-phenylpropylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 14852306 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-(3-phenylpropylsulfanyl)ethyl]propanamide |
| SMILES | Cc1cc(O)cc(C)c1CC(N)C(=O)NCCSCCCc1ccccc1 |
| InChI | InChI=1S/C22H30N2O2S/c1-16-13-19(25)14-17(2)20(16)15-21(23)22(26)24-10-12-27-11-6-9-18-7-4-3-5-8-18/h3-5,7-8,13-14,21,25H,6,9-12,15,23H2,1-2H3,(H,24,26) |
| InChIKey | ZMTYLTJWGZEGIG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|