C26H36N4O4 — CID 22849406
(2S)-N-[2-[acetamido(3-phenylpropanoyl)amino]-2-methylpropyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide (PubChem CID 22849406) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2S)-N-[2-[acetamido(3-phenylpropanoyl)amino]-2-methylpropyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide.
| Compound Name | (2S)-N-[2-[acetamido(3-phenylpropanoyl)amino]-2-methylpropyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 22849406 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (2S)-N-[2-[acetamido(3-phenylpropanoyl)amino]-2-methylpropyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
| SMILES | CC(=O)NN(C(=O)CCc1ccccc1)C(C)(C)CNC(=O)[C@@H](N)Cc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C26H36N4O4/c1-17-13-21(32)14-18(2)22(17)15-23(27)25(34)28-16-26(4,5)30(29-19(3)31)24(33)12-11-20-9-7-6-8-10-20/h6-10,13-14,23,32H,11-12,15-16,27H2,1-5H3,(H,28,34)(H,29,31)/t23-/m0/s1 |
| InChIKey | CQWTVVYHIHVVBL-QHCPKHFHSA-N |
| XLogP | 2.29 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|